C28H29N3O3 — CID 4877788
2-(4,4-dibenzyl-2,5-dioxoimidazolidin-1-yl)-N-(4-ethylphenyl)propanamide (PubChem CID 4877788) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(4,4-dibenzyl-2,5-dioxoimidazolidin-1-yl)-N-(4-ethylphenyl)propanamide.
| Compound Name | 2-(4,4-dibenzyl-2,5-dioxoimidazolidin-1-yl)-N-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 4877788 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(4,4-dibenzyl-2,5-dioxoimidazolidin-1-yl)-N-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(NC(=O)C(C)N2C(=O)NC(Cc3ccccc3)(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-3-21-14-16-24(17-15-21)29-25(32)20(2)31-26(33)28(30-27(31)34,18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-17,20H,3,18-19H2,1-2H3,(H,29,32)(H,30,34) |
| InChIKey | JMUWJXPWYYFXCJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|