C26H29N3O4 — CID 4884630
N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]phenoxy]acetamide (PubChem CID 4884630) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4884630 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-methoxy-4-[(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]phenoxy]acetamide |
| SMILES | COc1cc(C=C2N=C3CCCCCN3C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-17-8-10-20(13-18(17)2)27-25(30)16-33-22-11-9-19(15-23(22)32-3)14-21-26(31)29-12-6-4-5-7-24(29)28-21/h8-11,13-15H,4-7,12,16H2,1-3H3,(H,27,30) |
| InChIKey | GEWLLSLTSMCUIQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|