C22H17N5O5 — CID 4885953
N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-3-nitrobenzamide (PubChem CID 4885953) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-3-nitrobenzamide.
| Compound Name | N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4885953 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-3-nitrobenzamide |
| SMILES | N#CC(C(=O)N1CCOCC1)=C1N=C(NC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C22H17N5O5/c23-13-18(22(29)26-8-10-32-11-9-26)19-16-6-1-2-7-17(16)20(24-19)25-21(28)14-4-3-5-15(12-14)27(30)31/h1-7,12H,8-11H2,(H,24,25,28) |
| InChIKey | OFWDLCKZEPTTRX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|