C22H17FN4O3 — CID 4859667
N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-2-fluorobenzamide (PubChem CID 4859667) has the molecular formula C22H17FN4O3 and a molecular weight of 404.40 g/mol. Its IUPAC name is N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-2-fluorobenzamide.
| Compound Name | N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4859667 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[3-(1-cyano-2-morpholin-4-yl-2-oxoethylidene)isoindol-1-yl]-2-fluorobenzamide |
| SMILES | N#CC(C(=O)N1CCOCC1)=C1N=C(NC(=O)c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C22H17FN4O3/c23-18-8-4-3-7-16(18)21(28)26-20-15-6-2-1-5-14(15)19(25-20)17(13-24)22(29)27-9-11-30-12-10-27/h1-8H,9-12H2,(H,25,26,28) |
| InChIKey | UYPXBRWQVWVFEU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|