C26H19FN4O2 — CID 4887911
N-[3-[1-cyano-2-oxo-2-(1-phenylethylamino)ethylidene]isoindol-1-yl]-2-fluorobenzamide (PubChem CID 4887911) has the molecular formula C26H19FN4O2 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[3-[1-cyano-2-oxo-2-(1-phenylethylamino)ethylidene]isoindol-1-yl]-2-fluorobenzamide.
| Compound Name | N-[3-[1-cyano-2-oxo-2-(1-phenylethylamino)ethylidene]isoindol-1-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4887911 |
| Molecular Formula | C26H19FN4O2 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[3-[1-cyano-2-oxo-2-(1-phenylethylamino)ethylidene]isoindol-1-yl]-2-fluorobenzamide |
| SMILES | CC(NC(=O)C(C#N)=C1N=C(NC(=O)c2ccccc2F)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C26H19FN4O2/c1-16(17-9-3-2-4-10-17)29-26(33)21(15-28)23-18-11-5-6-12-19(18)24(30-23)31-25(32)20-13-7-8-14-22(20)27/h2-14,16H,1H3,(H,29,33)(H,30,31,32) |
| InChIKey | GIJTUEVEUVVZLB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|