C22H19FN4O3 — CID 7599378
N-[(3Z)-3-[1-cyano-2-(3-methoxypropylamino)-2-oxoethylidene]isoindol-1-yl]-2-fluorobenzamide (PubChem CID 7599378) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is N-[(3Z)-3-[1-cyano-2-(3-methoxypropylamino)-2-oxoethylidene]isoindol-1-yl]-2-fluorobenzamide.
| Compound Name | N-[(3Z)-3-[1-cyano-2-(3-methoxypropylamino)-2-oxoethylidene]isoindol-1-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 7599378 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(3Z)-3-[1-cyano-2-(3-methoxypropylamino)-2-oxoethylidene]isoindol-1-yl]-2-fluorobenzamide |
| SMILES | COCCCNC(=O)/C(C#N)=C1\N=C(NC(=O)c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C22H19FN4O3/c1-30-12-6-11-25-21(28)17(13-24)19-14-7-2-3-8-15(14)20(26-19)27-22(29)16-9-4-5-10-18(16)23/h2-5,7-10H,6,11-12H2,1H3,(H,25,28)(H,26,27,29)/b19-17- |
| InChIKey | YBWBRNJTVICYND-ZPHPHTNESA-N |
| XLogP | 2.40 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|