C26H20N4O4 — CID 6228552
N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4-dimethoxybenzamide (PubChem CID 6228552) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6228552 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2=N/C(=C(/C#N)C(=O)Nc3ccccc3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C26H20N4O4/c1-33-21-13-12-16(14-22(21)34-2)25(31)30-24-19-11-7-6-10-18(19)23(29-24)20(15-27)26(32)28-17-8-4-3-5-9-17/h3-14H,1-2H3,(H,28,32)(H,29,30,31)/b23-20- |
| InChIKey | NQWOSGJDZUCUQC-ATJXCDBQSA-N |
| XLogP | 3.77 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|