C27H22N4O5 — CID 4911483
N-[3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4,5-trimethoxybenzamide (PubChem CID 4911483) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is N-[3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4911483 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2=NC(=C(C#N)C(=O)Nc3ccccc3)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C27H22N4O5/c1-34-21-13-16(14-22(35-2)24(21)36-3)26(32)31-25-19-12-8-7-11-18(19)23(30-25)20(15-28)27(33)29-17-9-5-4-6-10-17/h4-14H,1-3H3,(H,29,33)(H,30,31,32) |
| InChIKey | DFMAFHKILLZFLQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|