C17H12N4O — CID 57236985
2-(3-aminoisoindol-1-ylidene)-2-cyano-N-phenylacetamide (PubChem CID 57236985) has the molecular formula C17H12N4O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-(3-aminoisoindol-1-ylidene)-2-cyano-N-phenylacetamide.
| Compound Name | 2-(3-aminoisoindol-1-ylidene)-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 57236985 |
| Molecular Formula | C17H12N4O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(3-aminoisoindol-1-ylidene)-2-cyano-N-phenylacetamide |
| SMILES | N#CC(C(=O)Nc1ccccc1)=C1N=C(N)c2ccccc21 |
| InChI | InChI=1S/C17H12N4O/c18-10-14(17(22)20-11-6-2-1-3-7-11)15-12-8-4-5-9-13(12)16(19)21-15/h1-9H,(H2,19,21)(H,20,22) |
| InChIKey | OGAMRAQUAIMWKV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|