C22H14N4O2S — CID 7595875
N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]thiophene-2-carboxamide (PubChem CID 7595875) has the molecular formula C22H14N4O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7595875 |
| Molecular Formula | C22H14N4O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[(3Z)-3-(2-anilino-1-cyano-2-oxoethylidene)isoindol-1-yl]thiophene-2-carboxamide |
| SMILES | N#C/C(C(=O)Nc1ccccc1)=C1/N=C(NC(=O)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C22H14N4O2S/c23-13-17(21(27)24-14-7-2-1-3-8-14)19-15-9-4-5-10-16(15)20(25-19)26-22(28)18-11-6-12-29-18/h1-12H,(H,24,27)(H,25,26,28)/b19-17- |
| InChIKey | OUXVIPAMXQCQHE-ZPHPHTNESA-N |
| XLogP | 3.81 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|