C17H10ClN3O2 — CID 44713861
(2Z)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-2-cyano-N-phenylacetamide (PubChem CID 44713861) has the molecular formula C17H10ClN3O2 and a molecular weight of 323.74 g/mol. Its IUPAC name is (2Z)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-2-cyano-N-phenylacetamide.
| Compound Name | (2Z)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-2-cyano-N-phenylacetamide |
|---|---|
| PubChem CID | 44713861 |
| Molecular Formula | C17H10ClN3O2 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (2Z)-2-(5-chloro-2-oxo-1H-indol-3-ylidene)-2-cyano-N-phenylacetamide |
| SMILES | N#C/C(C(=O)Nc1ccccc1)=C1/C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H10ClN3O2/c18-10-6-7-14-12(8-10)15(17(23)21-14)13(9-19)16(22)20-11-4-2-1-3-5-11/h1-8H,(H,20,22)(H,21,23)/b15-13- |
| InChIKey | HSNRGSCSLHHBTO-SQFISAMPSA-N |
| XLogP | 3.21 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|