C18H11BrN4O3 — CID 5161386
N-[(4-bromo-2-hydroxyphenyl)methylideneamino]-2-cyano-2-(2-oxo-1H-indol-3-ylidene)acetamide (PubChem CID 5161386) has the molecular formula C18H11BrN4O3 and a molecular weight of 411.22 g/mol. Its IUPAC name is N-[(4-bromo-2-hydroxyphenyl)methylideneamino]-2-cyano-2-(2-oxo-1H-indol-3-ylidene)acetamide.
| Compound Name | N-[(4-bromo-2-hydroxyphenyl)methylideneamino]-2-cyano-2-(2-oxo-1H-indol-3-ylidene)acetamide |
|---|---|
| PubChem CID | 5161386 |
| Molecular Formula | C18H11BrN4O3 |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | N-[(4-bromo-2-hydroxyphenyl)methylideneamino]-2-cyano-2-(2-oxo-1H-indol-3-ylidene)acetamide |
| SMILES | N#CC(C(=O)NN=Cc1ccc(Br)cc1O)=C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H11BrN4O3/c19-11-6-5-10(15(24)7-11)9-21-23-17(25)13(8-20)16-12-3-1-2-4-14(12)22-18(16)26/h1-7,9,24H,(H,22,26)(H,23,25) |
| InChIKey | NKVHCDQVMIPRCL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|