C9H9BrN2OS2 — CID 177412067
methyl N-[(E)-(4-bromo-2-hydroxyphenyl)methylideneamino]carbamodithioate (PubChem CID 177412067) has the molecular formula C9H9BrN2OS2 and a molecular weight of 305.22 g/mol. Its IUPAC name is methyl N-[(E)-(4-bromo-2-hydroxyphenyl)methylideneamino]carbamodithioate.
| Compound Name | methyl N-[(E)-(4-bromo-2-hydroxyphenyl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 177412067 |
| Molecular Formula | C9H9BrN2OS2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | methyl N-[(E)-(4-bromo-2-hydroxyphenyl)methylideneamino]carbamodithioate |
| SMILES | CSC(=S)N/N=C/c1ccc(Br)cc1O |
| InChI | InChI=1S/C9H9BrN2OS2/c1-15-9(14)12-11-5-6-2-3-7(10)4-8(6)13/h2-5,13H,1H3,(H,12,14)/b11-5+ |
| InChIKey | CECOXGGEOQLPDY-VZUCSPMQSA-N |
| XLogP | 2.73 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|