C12H7Br3N2O3 — CID 142499246
4,5-dibromo-N-[(4-bromo-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 142499246) has the molecular formula C12H7Br3N2O3 and a molecular weight of 466.91 g/mol. Its IUPAC name is 4,5-dibromo-N-[(4-bromo-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[(4-bromo-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 142499246 |
| Molecular Formula | C12H7Br3N2O3 |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 463.80 |
| IUPAC Name | 4,5-dibromo-N-[(4-bromo-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Br)cc1O)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C12H7Br3N2O3/c13-7-2-1-6(9(18)3-7)5-16-17-12(19)10-4-8(14)11(15)20-10/h1-5,18H,(H,17,19) |
| InChIKey | VJFCSYDHMJLYBK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|