C12H5F3N2O4 — CID 69024883
2-cyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetic acid (PubChem CID 69024883) has the molecular formula C12H5F3N2O4 and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-cyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetic acid.
| Compound Name | 2-cyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 69024883 |
| Molecular Formula | C12H5F3N2O4 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-cyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetic acid |
| SMILES | N#CC(C(=O)O)=C1C(=O)Nc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C12H5F3N2O4/c13-12(14,15)21-5-1-2-8-6(3-5)9(10(18)17-8)7(4-16)11(19)20/h1-3H,(H,17,18)(H,19,20) |
| InChIKey | GMJHOXPTAKAKMV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|