C13H7F3N2O4 — CID 58017109
methyl (2E)-2-isocyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetate (PubChem CID 58017109) has the molecular formula C13H7F3N2O4 and a molecular weight of 312.20 g/mol. Its IUPAC name is methyl (2E)-2-isocyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetate.
| Compound Name | methyl (2E)-2-isocyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetate |
|---|---|
| PubChem CID | 58017109 |
| Molecular Formula | C13H7F3N2O4 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | methyl (2E)-2-isocyano-2-[2-oxo-5-(trifluoromethoxy)-1H-indol-3-ylidene]acetate |
| SMILES | [C-]#[N+]/C(C(=O)OC)=C1/C(=O)Nc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H7F3N2O4/c1-17-10(12(20)21-2)9-7-5-6(22-13(14,15)16)3-4-8(7)18-11(9)19/h3-5H,2H3,(H,18,19)/b10-9+ |
| InChIKey | SJRNIUASZUPYIR-MDZDMXLPSA-N |
| XLogP | 2.34 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|