C18H12ClNO5 — CID 135317725
3-[chloro-(4-methoxycarbonylphenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid (PubChem CID 135317725) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is 3-[chloro-(4-methoxycarbonylphenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid.
| Compound Name | 3-[chloro-(4-methoxycarbonylphenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 135317725 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-[chloro-(4-methoxycarbonylphenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid |
| SMILES | COC(=O)c1ccc(C(Cl)=C2C(=O)Nc3ccc(C(=O)O)cc32)cc1 |
| InChI | InChI=1S/C18H12ClNO5/c1-25-18(24)10-4-2-9(3-5-10)15(19)14-12-8-11(17(22)23)6-7-13(12)20-16(14)21/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | FYRJRVPPNGDEGU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|