C16H10ClNO4 — CID 136589803
methyl 3-chloro-4-(2,3-dioxo-1H-indol-5-yl)benzoate (PubChem CID 136589803) has the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. Its IUPAC name is methyl 3-chloro-4-(2,3-dioxo-1H-indol-5-yl)benzoate.
| Compound Name | methyl 3-chloro-4-(2,3-dioxo-1H-indol-5-yl)benzoate |
|---|---|
| PubChem CID | 136589803 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 3-chloro-4-(2,3-dioxo-1H-indol-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3c(c2)C(=O)C(=O)N3)c(Cl)c1 |
| InChI | InChI=1S/C16H10ClNO4/c1-22-16(21)9-2-4-10(12(17)7-9)8-3-5-13-11(6-8)14(19)15(20)18-13/h2-7H,1H3,(H,18,19,20) |
| InChIKey | RMFWCHQYSIDQOB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|