C21H16Cl2N4O3 — CID 4909384
2,4-dichloro-N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]benzamide (PubChem CID 4909384) has the molecular formula C21H16Cl2N4O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]benzamide |
|---|---|
| PubChem CID | 4909384 |
| Molecular Formula | C21H16Cl2N4O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2,4-dichloro-N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]benzamide |
| SMILES | COCCNC(=O)C(C#N)=C1N=C(NC(=O)c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C21H16Cl2N4O3/c1-30-9-8-25-20(28)16(11-24)18-13-4-2-3-5-14(13)19(26-18)27-21(29)15-7-6-12(22)10-17(15)23/h2-7,10H,8-9H2,1H3,(H,25,28)(H,26,27,29) |
| InChIKey | LOZHAPIIFRCCSF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|