C24H20Cl2N4O3 — CID 42108509
2,4-dichloro-N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]benzamide (PubChem CID 42108509) has the molecular formula C24H20Cl2N4O3 and a molecular weight of 483.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]benzamide |
|---|---|
| PubChem CID | 42108509 |
| Molecular Formula | C24H20Cl2N4O3 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 2,4-dichloro-N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]benzamide |
| SMILES | C[C@@H]1CN(C(=O)/C(C#N)=C2\N=C(NC(=O)c3ccc(Cl)cc3Cl)c3ccccc32)C[C@H](C)O1 |
| InChI | InChI=1S/C24H20Cl2N4O3/c1-13-11-30(12-14(2)33-13)24(32)19(10-27)21-16-5-3-4-6-17(16)22(28-21)29-23(31)18-8-7-15(25)9-20(18)26/h3-9,13-14H,11-12H2,1-2H3,(H,28,29,31)/b21-19-/t13-,14+ |
| InChIKey | YCXPLKUXWIZFDJ-JNHSNXLYSA-N |
| XLogP | 4.05 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|