C25H24N4O3 — CID 6579459
N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]-4-methylbenzamide (PubChem CID 6579459) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]-4-methylbenzamide.
| Compound Name | N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 6579459 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[(3Z)-3-[1-cyano-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethylidene]isoindol-1-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2=N/C(=C(/C#N)C(=O)N3C[C@@H](C)O[C@@H](C)C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-15-8-10-18(11-9-15)24(30)28-23-20-7-5-4-6-19(20)22(27-23)21(12-26)25(31)29-13-16(2)32-17(3)14-29/h4-11,16-17H,13-14H2,1-3H3,(H,27,28,30)/b22-21-/t16-,17+ |
| InChIKey | ATGVSZAHRLOYCK-SYDAPRMOSA-N |
| XLogP | 3.06 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|