C26H28N4O2 — CID 4975720
4-tert-butyl-N-[3-[1-cyano-2-(2-methylpropylamino)-2-oxoethylidene]isoindol-1-yl]benzamide (PubChem CID 4975720) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[1-cyano-2-(2-methylpropylamino)-2-oxoethylidene]isoindol-1-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[1-cyano-2-(2-methylpropylamino)-2-oxoethylidene]isoindol-1-yl]benzamide |
|---|---|
| PubChem CID | 4975720 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-tert-butyl-N-[3-[1-cyano-2-(2-methylpropylamino)-2-oxoethylidene]isoindol-1-yl]benzamide |
| SMILES | CC(C)CNC(=O)C(C#N)=C1N=C(NC(=O)c2ccc(C(C)(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H28N4O2/c1-16(2)15-28-25(32)21(14-27)22-19-8-6-7-9-20(19)23(29-22)30-24(31)17-10-12-18(13-11-17)26(3,4)5/h6-13,16H,15H2,1-5H3,(H,28,32)(H,29,30,31) |
| InChIKey | DESOSGHDFMXJAG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|