C27H21N5O5 — CID 4892267
N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-nitrobenzamide (PubChem CID 4892267) has the molecular formula C27H21N5O5 and a molecular weight of 495.50 g/mol. Its IUPAC name is N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4892267 |
| Molecular Formula | C27H21N5O5 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-nitrobenzamide |
| SMILES | COc1ccc(CCNC(=O)C(C#N)=C2N=C(NC(=O)c3ccc([N+](=O)[O-])cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H21N5O5/c1-37-20-12-6-17(7-13-20)14-15-29-27(34)23(16-28)24-21-4-2-3-5-22(21)25(30-24)31-26(33)18-8-10-19(11-9-18)32(35)36/h2-13H,14-15H2,1H3,(H,29,34)(H,30,31,33) |
| InChIKey | QDDWMEGMQXYINX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|