C28H24N4O4 — CID 4860255
N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide (PubChem CID 4860255) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide.
| Compound Name | N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4860255 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[3-[1-cyano-2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(CCNC(=O)C(C#N)=C2N=C(NC(=O)c3ccc(OC)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H24N4O4/c1-35-20-11-7-18(8-12-20)15-16-30-28(34)24(17-29)25-22-5-3-4-6-23(22)26(31-25)32-27(33)19-9-13-21(36-2)14-10-19/h3-14H,15-16H2,1-2H3,(H,30,34)(H,31,32,33) |
| InChIKey | MUQBBTNRJMFSNF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|