C22H20N4O4 — CID 4908068
N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide (PubChem CID 4908068) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide.
| Compound Name | N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4908068 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[3-[1-cyano-2-(2-methoxyethylamino)-2-oxoethylidene]isoindol-1-yl]-4-methoxybenzamide |
| SMILES | COCCNC(=O)C(C#N)=C1N=C(NC(=O)c2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H20N4O4/c1-29-12-11-24-22(28)18(13-23)19-16-5-3-4-6-17(16)20(25-19)26-21(27)14-7-9-15(30-2)10-8-14/h3-10H,11-12H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | OFKYPCAEZNSUER-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|