C23H23Cl2N5O2S2 — CID 4887451
tert-butyl N-[1-[6-[(2,6-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-phenylethyl]carbamate (PubChem CID 4887451) has the molecular formula C23H23Cl2N5O2S2 and a molecular weight of 536.51 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[(2,6-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[(2,6-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 4887451 |
| Molecular Formula | C23H23Cl2N5O2S2 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | tert-butyl N-[1-[6-[(2,6-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)c1nnc2sc(SCc3c(Cl)cccc3Cl)nn12 |
| InChI | InChI=1S/C23H23Cl2N5O2S2/c1-23(2,3)32-21(31)26-18(12-14-8-5-4-6-9-14)19-27-28-20-30(19)29-22(34-20)33-13-15-16(24)10-7-11-17(15)25/h4-11,18H,12-13H2,1-3H3,(H,26,31) |
| InChIKey | DHVMKRAEQXUBEE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |