C19H24ClN5O2S2 — CID 4885911
tert-butyl N-[1-[6-[(4-chlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylpropyl]carbamate (PubChem CID 4885911) has the molecular formula C19H24ClN5O2S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[(4-chlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[(4-chlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 4885911 |
| Molecular Formula | C19H24ClN5O2S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | tert-butyl N-[1-[6-[(4-chlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylpropyl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)c1nnc2sc(SCc3ccc(Cl)cc3)nn12 |
| InChI | InChI=1S/C19H24ClN5O2S2/c1-11(2)14(21-17(26)27-19(3,4)5)15-22-23-16-25(15)24-18(29-16)28-10-12-6-8-13(20)9-7-12/h6-9,11,14H,10H2,1-5H3,(H,21,26) |
| InChIKey | MWELPVQWCVIULF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |