C17H28N6O3S2 — CID 4890427
tert-butyl N-[1-[6-[2-(dimethylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutyl]carbamate (PubChem CID 4890427) has the molecular formula C17H28N6O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[2-(dimethylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[2-(dimethylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 4890427 |
| Molecular Formula | C17H28N6O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl N-[1-[6-[2-(dimethylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutyl]carbamate |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)c1nnc2sc(SCC(=O)N(C)C)nn12 |
| InChI | InChI=1S/C17H28N6O3S2/c1-8-10(2)12(18-15(25)26-17(3,4)5)13-19-20-14-23(13)21-16(28-14)27-9-11(24)22(6)7/h10,12H,8-9H2,1-7H3,(H,18,25) |
| InChIKey | RIHMBKJJYZKSON-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |