C15H17Cl2N5S2 — CID 2036642
(1S,2S)-1-[6-[(3,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutan-1-amine (PubChem CID 2036642) has the molecular formula C15H17Cl2N5S2 and a molecular weight of 402.38 g/mol. Its IUPAC name is (1S,2S)-1-[6-[(3,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutan-1-amine.
| Compound Name | (1S,2S)-1-[6-[(3,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 2036642 |
| Molecular Formula | C15H17Cl2N5S2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (1S,2S)-1-[6-[(3,4-dichlorophenyl)methylsulfanyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-2-methylbutan-1-amine |
| SMILES | CC[C@H](C)[C@H](N)c1nnc2sc(SCc3ccc(Cl)c(Cl)c3)nn12 |
| InChI | InChI=1S/C15H17Cl2N5S2/c1-3-8(2)12(18)13-19-20-14-22(13)21-15(24-14)23-7-9-4-5-10(16)11(17)6-9/h4-6,8,12H,3,7,18H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | SIFQRIFJFHCAPL-UFBFGSQYSA-N |
| XLogP | 4.83 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |