C15H20N5S2+ — CID 2040192
[(1S,2S)-1-(6-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)-2-methylbutyl]azanium (PubChem CID 2040192) has the molecular formula C15H20N5S2+ and a molecular weight of 334.49 g/mol. Its IUPAC name is [(1S,2S)-1-(6-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)-2-methylbutyl]azanium.
| Compound Name | [(1S,2S)-1-(6-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)-2-methylbutyl]azanium |
|---|---|
| PubChem CID | 2040192 |
| Molecular Formula | C15H20N5S2+ |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(1S,2S)-1-(6-benzylsulfanyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)-2-methylbutyl]azanium |
| SMILES | CC[C@H](C)[C@H]([NH3+])c1nnc2sc(SCc3ccccc3)nn12 |
| InChI | InChI=1S/C15H19N5S2/c1-3-10(2)12(16)13-17-18-14-20(13)19-15(22-14)21-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9,16H2,1-2H3/p+1/t10-,12-/m0/s1 |
| InChIKey | HTRAAKFPSWPYLV-JQWIXIFHSA-O |
| XLogP | 2.81 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |