C26H22N2O3 — CID 4888137
3-[(4-phenylmethoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 4888137) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[(4-phenylmethoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | 3-[(4-phenylmethoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 4888137 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[(4-phenylmethoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | O=C1NC(=Cc2ccc(OCc3ccccc3)cc2)C(=O)N2Cc3ccccc3CC12 |
| InChI | InChI=1S/C26H22N2O3/c29-25-24-15-20-8-4-5-9-21(20)16-28(24)26(30)23(27-25)14-18-10-12-22(13-11-18)31-17-19-6-2-1-3-7-19/h1-14,24H,15-17H2,(H,27,29) |
| InChIKey | MQEVTJHPRJYASZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|