C27H24N4 — CID 4888810
7-butyl-2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine (PubChem CID 4888810) has the molecular formula C27H24N4 and a molecular weight of 404.52 g/mol. Its IUPAC name is 7-butyl-2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 7-butyl-2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 4888810 |
| Molecular Formula | C27H24N4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 7-butyl-2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine |
| SMILES | CCCCc1c(-c2ccccc2)nc2nc(-c3ccccc3)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C27H24N4/c1-2-3-19-23-24(20-13-7-4-8-14-20)28-27-29-25(21-15-9-5-10-16-21)26(30-31(23)27)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3 |
| InChIKey | IJFRWKKNWLCNGM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |