C23H22N2O6 — CID 4890430
5-[3-(2,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 4890430) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[3-(2,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 5-[3-(2,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4890430 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-[3-(2,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C=CC(=O)c2c(O)n(CCc3ccccc3)c(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-30-17-10-8-16(19(14-17)31-2)9-11-18(26)20-21(27)24-23(29)25(22(20)28)13-12-15-6-4-3-5-7-15/h3-11,14,28H,12-13H2,1-2H3,(H,24,27,29) |
| InChIKey | FNUWAUNCFDCSTG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|