C25H34N4O3S — CID 4890543
1,3-bis(4-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-1,3,5-triazinane-2-thione (PubChem CID 4890543) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-1,3,5-triazinane-2-thione.
| Compound Name | 1,3-bis(4-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 4890543 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)-5-(2-morpholin-4-ylethyl)-1,3,5-triazinane-2-thione |
| SMILES | CCOc1ccc(N2CN(CCN3CCOCC3)CN(c3ccc(OCC)cc3)C2=S)cc1 |
| InChI | InChI=1S/C25H34N4O3S/c1-3-31-23-9-5-21(6-10-23)28-19-27(14-13-26-15-17-30-18-16-26)20-29(25(28)33)22-7-11-24(12-8-22)32-4-2/h5-12H,3-4,13-20H2,1-2H3 |
| InChIKey | NMWMIYLNXQIHKA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|