C20H15FN4O3 — CID 48908703
2-cyano-5-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-3-oxo-N-pyridin-2-ylpentanamide (PubChem CID 48908703) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is 2-cyano-5-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-3-oxo-N-pyridin-2-ylpentanamide.
| Compound Name | 2-cyano-5-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-3-oxo-N-pyridin-2-ylpentanamide |
|---|---|
| PubChem CID | 48908703 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-cyano-5-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-3-oxo-N-pyridin-2-ylpentanamide |
| SMILES | N#CC(C(=O)CCc1ncc(-c2ccc(F)cc2)o1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C20H15FN4O3/c21-14-6-4-13(5-7-14)17-12-24-19(28-17)9-8-16(26)15(11-22)20(27)25-18-3-1-2-10-23-18/h1-7,10,12,15H,8-9H2,(H,23,25,27) |
| InChIKey | MAEYYEVEANRTFW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|