C19H19N3O3 — CID 98506736
(2S)-2-cyano-5-(4-ethoxyphenyl)-3-oxo-N-pyridin-2-ylpentanamide (PubChem CID 98506736) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-2-cyano-5-(4-ethoxyphenyl)-3-oxo-N-pyridin-2-ylpentanamide.
| Compound Name | (2S)-2-cyano-5-(4-ethoxyphenyl)-3-oxo-N-pyridin-2-ylpentanamide |
|---|---|
| PubChem CID | 98506736 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2S)-2-cyano-5-(4-ethoxyphenyl)-3-oxo-N-pyridin-2-ylpentanamide |
| SMILES | CCOc1ccc(CCC(=O)[C@H](C#N)C(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-25-15-9-6-14(7-10-15)8-11-17(23)16(13-20)19(24)22-18-5-3-4-12-21-18/h3-7,9-10,12,16H,2,8,11H2,1H3,(H,21,22,24)/t16-/m0/s1 |
| InChIKey | NUJFPMBQCBYWID-INIZCTEOSA-N |
| XLogP | 2.76 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|