C19H16N2O6S — CID 4891450
2-[[3-[(3-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid (PubChem CID 4891450) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is 2-[[3-[(3-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid.
| Compound Name | 2-[[3-[(3-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 4891450 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-[[3-[(3-methoxycarbonylphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid |
| SMILES | COC(=O)c1cccc(CN2C(=O)SC(Nc3ccccc3C(=O)O)C2=O)c1 |
| InChI | InChI=1S/C19H16N2O6S/c1-27-18(25)12-6-4-5-11(9-12)10-21-16(22)15(28-19(21)26)20-14-8-3-2-7-13(14)17(23)24/h2-9,15,20H,10H2,1H3,(H,23,24) |
| InChIKey | GDRZUXDTOAEAER-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|