C12H11ClN2O4S — CID 42416046
2-[[(5S)-3-(2-chloroethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid (PubChem CID 42416046) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is 2-[[(5S)-3-(2-chloroethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid.
| Compound Name | 2-[[(5S)-3-(2-chloroethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 42416046 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-[[(5S)-3-(2-chloroethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1N[C@H]1SC(=O)N(CCCl)C1=O |
| InChI | InChI=1S/C12H11ClN2O4S/c13-5-6-15-10(16)9(20-12(15)19)14-8-4-2-1-3-7(8)11(17)18/h1-4,9,14H,5-6H2,(H,17,18)/t9-/m0/s1 |
| InChIKey | MIRMPTOVHQDWFA-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|