C12H13ClN2O2S — CID 42416059
(5R)-3-(2-chloroethyl)-5-(2-methylanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 42416059) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is (5R)-3-(2-chloroethyl)-5-(2-methylanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-3-(2-chloroethyl)-5-(2-methylanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42416059 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (5R)-3-(2-chloroethyl)-5-(2-methylanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccccc1N[C@@H]1SC(=O)N(CCCl)C1=O |
| InChI | InChI=1S/C12H13ClN2O2S/c1-8-4-2-3-5-9(8)14-10-11(16)15(7-6-13)12(17)18-10/h2-5,10,14H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | QRAXBBPNIDGBPL-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|