C14H13N2O6S- — CID 7162240
2-[[(5S)-3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate (PubChem CID 7162240) has the molecular formula C14H13N2O6S- and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-[[(5S)-3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate.
| Compound Name | 2-[[(5S)-3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 7162240 |
| Molecular Formula | C14H13N2O6S- |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[[(5S)-3-(2-ethoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)CN1C(=O)S[C@H](Nc2ccccc2C(=O)[O-])C1=O |
| InChI | InChI=1S/C14H14N2O6S/c1-2-22-10(17)7-16-12(18)11(23-14(16)21)15-9-6-4-3-5-8(9)13(19)20/h3-6,11,15H,2,7H2,1H3,(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | BZAYRWKOJBITLY-NSHDSACASA-M |
| XLogP | 0.05 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|