C12H11N2O4S- — CID 2049929
2-[(5S)-5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 2049929) has the molecular formula C12H11N2O4S- and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[(5S)-5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5S)-5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 2049929 |
| Molecular Formula | C12H11N2O4S- |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[(5S)-5-(4-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | Cc1ccc(N[C@H]2SC(=O)N(CC(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c1-7-2-4-8(5-3-7)13-10-11(17)14(6-9(15)16)12(18)19-10/h2-5,10,13H,6H2,1H3,(H,15,16)/p-1/t10-/m0/s1 |
| InChIKey | ADTBADZKVHGQJQ-JTQLQIEISA-M |
| XLogP | 0.18 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|