C13H16N2O3S — CID 51566651
(5S)-5-(4-methoxyanilino)-3-propyl-1,3-thiazolidine-2,4-dione (PubChem CID 51566651) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is (5S)-5-(4-methoxyanilino)-3-propyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-methoxyanilino)-3-propyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 51566651 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (5S)-5-(4-methoxyanilino)-3-propyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1C(=O)S[C@H](Nc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C13H16N2O3S/c1-3-8-15-12(16)11(19-13(15)17)14-9-4-6-10(18-2)7-5-9/h4-7,11,14H,3,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | UBFPLCLLFRACBB-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|