C12H13BrN2O3S — CID 42416035
(5R)-3-(2-bromoethyl)-5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 42416035) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is (5R)-3-(2-bromoethyl)-5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-3-(2-bromoethyl)-5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42416035 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | (5R)-3-(2-bromoethyl)-5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(N[C@@H]2SC(=O)N(CCBr)C2=O)cc1 |
| InChI | InChI=1S/C12H13BrN2O3S/c1-18-9-4-2-8(3-5-9)14-10-11(16)15(7-6-13)12(17)19-10/h2-5,10,14H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | VCQJVPWQWDZIGS-SNVBAGLBSA-N |
| XLogP | 2.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|