C19H14BrN3O4S — CID 41024005
(5S)-5-(4-bromoanilino)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 41024005) has the molecular formula C19H14BrN3O4S and a molecular weight of 460.31 g/mol. Its IUPAC name is (5S)-5-(4-bromoanilino)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-bromoanilino)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 41024005 |
| Molecular Formula | C19H14BrN3O4S |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | (5S)-5-(4-bromoanilino)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@H](Nc2ccc(Br)cc2)C(=O)N1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14BrN3O4S/c20-11-5-7-12(8-6-11)21-15-18(26)23(19(27)28-15)10-9-22-16(24)13-3-1-2-4-14(13)17(22)25/h1-8,15,21H,9-10H2/t15-/m0/s1 |
| InChIKey | MNNCBKOCJXURKG-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|