C14H18N2O2S — CID 7195463
(5R)-3-butyl-5-(3-methylanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 7195463) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (5R)-3-butyl-5-(3-methylanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-3-butyl-5-(3-methylanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 7195463 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (5R)-3-butyl-5-(3-methylanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)S[C@@H](Nc2cccc(C)c2)C1=O |
| InChI | InChI=1S/C14H18N2O2S/c1-3-4-8-16-13(17)12(19-14(16)18)15-11-7-5-6-10(2)9-11/h5-7,9,12,15H,3-4,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | DZSMLMDZUGXUEX-GFCCVEGCSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|