C19H21N3O2S — CID 16643925
5-(4-methylanilino)-3-[2-(3-methylanilino)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 16643925) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-(4-methylanilino)-3-[2-(3-methylanilino)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(4-methylanilino)-3-[2-(3-methylanilino)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 16643925 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-(4-methylanilino)-3-[2-(3-methylanilino)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(NC2SC(=O)N(CCNc3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-13-6-8-15(9-7-13)21-17-18(23)22(19(24)25-17)11-10-20-16-5-3-4-14(2)12-16/h3-9,12,17,20-21H,10-11H2,1-2H3 |
| InChIKey | SKMYZJJJAVAUCV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|