C11H10ClN3O4S — CID 42416048
(5S)-3-(2-chloroethyl)-5-(3-nitroanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 42416048) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is (5S)-3-(2-chloroethyl)-5-(3-nitroanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-3-(2-chloroethyl)-5-(3-nitroanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42416048 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (5S)-3-(2-chloroethyl)-5-(3-nitroanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@H](Nc2cccc([N+](=O)[O-])c2)C(=O)N1CCCl |
| InChI | InChI=1S/C11H10ClN3O4S/c12-4-5-14-10(16)9(20-11(14)17)13-7-2-1-3-8(6-7)15(18)19/h1-3,6,9,13H,4-5H2/t9-/m0/s1 |
| InChIKey | DUWYTLKPTYWVPV-VIFPVBQESA-N |
| XLogP | 2.27 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|