C18H15N2O4S- — CID 7162204
4-[[(5S)-5-(2-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 7162204) has the molecular formula C18H15N2O4S- and a molecular weight of 355.40 g/mol. Its IUPAC name is 4-[[(5S)-5-(2-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | 4-[[(5S)-5-(2-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 7162204 |
| Molecular Formula | C18H15N2O4S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-[[(5S)-5-(2-methylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | Cc1ccccc1N[C@H]1SC(=O)N(Cc2ccc(C(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C18H16N2O4S/c1-11-4-2-3-5-14(11)19-15-16(21)20(18(24)25-15)10-12-6-8-13(9-7-12)17(22)23/h2-9,15,19H,10H2,1H3,(H,22,23)/p-1/t15-/m0/s1 |
| InChIKey | GNONUVSHHLFZAU-HNNXBMFYSA-M |
| XLogP | 1.99 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|