C17H12N3O6S- — CID 7162252
4-[[(5S)-3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate (PubChem CID 7162252) has the molecular formula C17H12N3O6S- and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-[[(5S)-3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate.
| Compound Name | 4-[[(5S)-3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 7162252 |
| Molecular Formula | C17H12N3O6S- |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-[[(5S)-3-[(4-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
| SMILES | O=C([O-])c1ccc(N[C@H]2SC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H13N3O6S/c21-15-14(18-12-5-3-11(4-6-12)16(22)23)27-17(24)19(15)9-10-1-7-13(8-2-10)20(25)26/h1-8,14,18H,9H2,(H,22,23)/p-1/t14-/m0/s1 |
| InChIKey | JLENHWYNKUJUEE-AWEZNQCLSA-M |
| XLogP | 1.59 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|