C22H25N5O4 — CID 4895743
1,3,5',16'-tetramethylspiro[1,3-diazinane-5,8'-2,12,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),13,15,17-tetraene]-2,4,6,11'-tetrone (PubChem CID 4895743) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1,3,5',16'-tetramethylspiro[1,3-diazinane-5,8'-2,12,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),13,15,17-tetraene]-2,4,6,11'-tetrone.
| Compound Name | 1,3,5',16'-tetramethylspiro[1,3-diazinane-5,8'-2,12,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),13,15,17-tetraene]-2,4,6,11'-tetrone |
|---|---|
| PubChem CID | 4895743 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1,3,5',16'-tetramethylspiro[1,3-diazinane-5,8'-2,12,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),13,15,17-tetraene]-2,4,6,11'-tetrone |
| SMILES | Cc1cccn2c(=O)c3c(nc12)N1CCC(C)CC1C1(C3)C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C22H25N5O4/c1-12-7-9-26-15(10-12)22(19(29)24(3)21(31)25(4)20(22)30)11-14-17(26)23-16-13(2)6-5-8-27(16)18(14)28/h5-6,8,12,15H,7,9-11H2,1-4H3 |
| InChIKey | LPJOKDAQSOWFRK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|